C14H14FeO — CID 140706938
cyclopenta-1,3-diene;2-(cyclopenta-1,3-dien-1-ylmethyl)prop-2-enal;iron(2+) (PubChem CID 140706938) has the molecular formula C14H14FeO and a molecular weight of 254.11 g/mol. Its IUPAC name is cyclopenta-1,3-diene;2-(cyclopenta-1,3-dien-1-ylmethyl)prop-2-enal;iron(2+).
| Compound Name | cyclopenta-1,3-diene;2-(cyclopenta-1,3-dien-1-ylmethyl)prop-2-enal;iron(2+) |
|---|---|
| PubChem CID | 140706938 |
| Molecular Formula | C14H14FeO |
| Molecular Weight | 254.11 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | cyclopenta-1,3-diene;2-(cyclopenta-1,3-dien-1-ylmethyl)prop-2-enal;iron(2+) |
| SMILES | C=C(C=O)Cc1ccc[cH-]1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C9H9O.C5H5.Fe/c1-8(7-10)6-9-4-2-3-5-9;1-2-4-5-3-1;/h2-5,7H,1,6H2;1-5H;/q2*-1;+2 |
| InChIKey | AIFPCOHWUCPYBT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.11 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|