C14H18FeS — CID 158425744
cyclopenta-1,3-diene;4-cyclopenta-1,3-dien-1-ylbutane-1-thiol;iron(2+) (PubChem CID 158425744) has the molecular formula C14H18FeS and a molecular weight of 274.21 g/mol. Its IUPAC name is cyclopenta-1,3-diene;4-cyclopenta-1,3-dien-1-ylbutane-1-thiol;iron(2+).
| Compound Name | cyclopenta-1,3-diene;4-cyclopenta-1,3-dien-1-ylbutane-1-thiol;iron(2+) |
|---|---|
| PubChem CID | 158425744 |
| Molecular Formula | C14H18FeS |
| Molecular Weight | 274.21 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | cyclopenta-1,3-diene;4-cyclopenta-1,3-dien-1-ylbutane-1-thiol;iron(2+) |
| SMILES | SCCCCc1ccc[cH-]1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C9H13S.C5H5.Fe/c10-8-4-3-7-9-5-1-2-6-9;1-2-4-5-3-1;/h1-2,5-6,10H,3-4,7-8H2;1-5H;/q2*-1;+2 |
| InChIKey | HBAINBRIBQIUDP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.21 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|