C18H26Ti — CID 159034563
bis(1-butylcyclopenta-1,3-diene);titanium(2+) (PubChem CID 159034563) has the molecular formula C18H26Ti and a molecular weight of 290.27 g/mol. Its IUPAC name is bis(1-butylcyclopenta-1,3-diene);titanium(2+).
| Compound Name | bis(1-butylcyclopenta-1,3-diene);titanium(2+) |
|---|---|
| PubChem CID | 159034563 |
| Molecular Formula | C18H26Ti |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | bis(1-butylcyclopenta-1,3-diene);titanium(2+) |
| SMILES | CCCCc1ccc[cH-]1.CCCCc1ccc[cH-]1.[Ti+2] |
| InChI | InChI=1S/2C9H13.Ti/c2*1-2-3-6-9-7-4-5-8-9;/h2*4-5,7-8H,2-3,6H2,1H3;/q2*-1;+2 |
| InChIKey | JVHMTQMSMRRDLB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|