C14H18Zr — CID 160781106
1-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;zirconium(2+) (PubChem CID 160781106) has the molecular formula C14H18Zr and a molecular weight of 277.52 g/mol. Its IUPAC name is 1-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;zirconium(2+).
| Compound Name | 1-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;zirconium(2+) |
|---|---|
| PubChem CID | 160781106 |
| Molecular Formula | C14H18Zr |
| Molecular Weight | 277.52 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 1-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;zirconium(2+) |
| SMILES | CCCCc1ccc[cH-]1.[Zr+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C9H13.C5H5.Zr/c1-2-3-6-9-7-4-5-8-9;1-2-4-5-3-1;/h4-5,7-8H,2-3,6H2,1H3;1-5H;/q2*-1;+2 |
| InChIKey | SAOVUWZNUQQZSN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|