C18H27FeP — CID 160916773
cyclopenta-1,3-diene;dibutyl(cyclopenta-1,3-dien-1-yl)phosphane;iron(2+) (PubChem CID 160916773) has the molecular formula C18H27FeP and a molecular weight of 330.23 g/mol. Its IUPAC name is cyclopenta-1,3-diene;dibutyl(cyclopenta-1,3-dien-1-yl)phosphane;iron(2+).
| Compound Name | cyclopenta-1,3-diene;dibutyl(cyclopenta-1,3-dien-1-yl)phosphane;iron(2+) |
|---|---|
| PubChem CID | 160916773 |
| Molecular Formula | C18H27FeP |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | cyclopenta-1,3-diene;dibutyl(cyclopenta-1,3-dien-1-yl)phosphane;iron(2+) |
| SMILES | CCCCP(CCCC)c1ccc[cH-]1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C13H22P.C5H5.Fe/c1-3-5-11-14(12-6-4-2)13-9-7-8-10-13;1-2-4-5-3-1;/h7-10H,3-6,11-12H2,1-2H3;1-5H;/q2*-1;+2 |
| InChIKey | SRMQLRVDDVQRFE-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|