C24H38Fe — CID 153281106
1-butyl-5-decylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+) (PubChem CID 153281106) has the molecular formula C24H38Fe and a molecular weight of 382.41 g/mol. Its IUPAC name is 1-butyl-5-decylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+).
| Compound Name | 1-butyl-5-decylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 153281106 |
| Molecular Formula | C24H38Fe |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 1-butyl-5-decylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+) |
| SMILES | CCCCCCCCCC[c-]1cccc1CCCC.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C19H33.C5H5.Fe/c1-3-5-7-8-9-10-11-12-15-19-17-13-16-18(19)14-6-4-2;1-2-4-5-3-1;/h13,16-17H,3-12,14-15H2,1-2H3;1-5H;/q2*-1;+2 |
| InChIKey | BFSZGFXRFOWUMG-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|