C22H34Fe-6 — CID 173056293
cyclopentane;1,5-dihexylcyclopenta-1,3-diene;iron (PubChem CID 173056293) has the molecular formula C22H34Fe-6 and a molecular weight of 354.36 g/mol. Its IUPAC name is cyclopentane;1,5-dihexylcyclopenta-1,3-diene;iron.
| Compound Name | cyclopentane;1,5-dihexylcyclopenta-1,3-diene;iron |
|---|---|
| PubChem CID | 173056293 |
| Molecular Formula | C22H34Fe-6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | cyclopentane;1,5-dihexylcyclopenta-1,3-diene;iron |
| SMILES | CCCCCCc1ccc[c-]1CCCCCC.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C17H29.C5H5.Fe/c1-3-5-7-9-12-16-14-11-15-17(16)13-10-8-6-4-2;1-2-4-5-3-1;/h11,14-15H,3-10,12-13H2,1-2H3;1-5H;/q-1;-5; |
| InChIKey | LDCHMVDSOXFOHG-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|