C18H26Fe-6 — CID 173322079
cyclopentane;1,5-dibutylcyclopenta-1,3-diene;iron (PubChem CID 173322079) has the molecular formula C18H26Fe-6 and a molecular weight of 298.25 g/mol. Its IUPAC name is cyclopentane;1,5-dibutylcyclopenta-1,3-diene;iron.
| Compound Name | cyclopentane;1,5-dibutylcyclopenta-1,3-diene;iron |
|---|---|
| PubChem CID | 173322079 |
| Molecular Formula | C18H26Fe-6 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | cyclopentane;1,5-dibutylcyclopenta-1,3-diene;iron |
| SMILES | CCCCc1ccc[c-]1CCCC.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C13H21.C5H5.Fe/c1-3-5-8-12-10-7-11-13(12)9-6-4-2;1-2-4-5-3-1;/h7,10-11H,3-6,8-9H2,1-2H3;1-5H;/q-1;-5; |
| InChIKey | RJWVYHOXCQQRNY-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|