C14H18FeO — CID 146026361
cyclopenta-1,3-diene;iron(2+);(2-propylcyclopenta-2,4-dien-1-yl)methanol (PubChem CID 146026361) has the molecular formula C14H18FeO and a molecular weight of 258.14 g/mol. Its IUPAC name is cyclopenta-1,3-diene;iron(2+);(2-propylcyclopenta-2,4-dien-1-yl)methanol.
| Compound Name | cyclopenta-1,3-diene;iron(2+);(2-propylcyclopenta-2,4-dien-1-yl)methanol |
|---|---|
| PubChem CID | 146026361 |
| Molecular Formula | C14H18FeO |
| Molecular Weight | 258.14 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | cyclopenta-1,3-diene;iron(2+);(2-propylcyclopenta-2,4-dien-1-yl)methanol |
| SMILES | CCCc1ccc[c-]1CO.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C9H13O.C5H5.Fe/c1-2-4-8-5-3-6-9(8)7-10;1-2-4-5-3-1;/h3,5-6,10H,2,4,7H2,1H3;1-5H;/q2*-1;+2 |
| InChIKey | KHPZQXJOUJOKAM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.14 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|