C14H17FeNO — CID 164897890
1-[5-(2-aminoethyl)cyclopenta-1,3-dien-1-yl]ethanone;cyclopenta-1,3-diene;iron(2+) (PubChem CID 164897890) has the molecular formula C14H17FeNO and a molecular weight of 271.14 g/mol. Its IUPAC name is 1-[5-(2-aminoethyl)cyclopenta-1,3-dien-1-yl]ethanone;cyclopenta-1,3-diene;iron(2+).
| Compound Name | 1-[5-(2-aminoethyl)cyclopenta-1,3-dien-1-yl]ethanone;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 164897890 |
| Molecular Formula | C14H17FeNO |
| Molecular Weight | 271.14 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 1-[5-(2-aminoethyl)cyclopenta-1,3-dien-1-yl]ethanone;cyclopenta-1,3-diene;iron(2+) |
| SMILES | CC(=O)c1ccc[c-]1CCN.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C9H12NO.C5H5.Fe/c1-7(11)9-4-2-3-8(9)5-6-10;1-2-4-5-3-1;/h2-4H,5-6,10H2,1H3;1-5H;/q2*-1;+2 |
| InChIKey | DXJIQRNCJXNNHI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.14 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|