C12H12FeO2 — CID 15768501
cyclopenta-1,3-diene;2-cyclopenta-2,4-dien-1-ylacetic acid;iron(2+) (PubChem CID 15768501) has the molecular formula C12H12FeO2 and a molecular weight of 244.07 g/mol. Its IUPAC name is cyclopenta-1,3-diene;2-cyclopenta-2,4-dien-1-ylacetic acid;iron(2+).
| Compound Name | cyclopenta-1,3-diene;2-cyclopenta-2,4-dien-1-ylacetic acid;iron(2+) |
|---|---|
| PubChem CID | 15768501 |
| Molecular Formula | C12H12FeO2 |
| Molecular Weight | 244.07 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | cyclopenta-1,3-diene;2-cyclopenta-2,4-dien-1-ylacetic acid;iron(2+) |
| SMILES | O=C(O)C[c-]1cccc1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C7H7O2.C5H5.Fe/c8-7(9)5-6-3-1-2-4-6;1-2-4-5-3-1;/h1-4H,5H2,(H,8,9);1-5H;/q2*-1;+2 |
| InChIKey | MOUVOWJUMAKBBM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.07 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|