C15H19FeNO — CID 15494645
cyclopenta-1,3-diene;4-(cyclopenta-2,4-dien-1-ylmethyl)morpholine;iron(2+) (PubChem CID 15494645) has the molecular formula C15H19FeNO and a molecular weight of 285.17 g/mol. Its IUPAC name is cyclopenta-1,3-diene;4-(cyclopenta-2,4-dien-1-ylmethyl)morpholine;iron(2+).
| Compound Name | cyclopenta-1,3-diene;4-(cyclopenta-2,4-dien-1-ylmethyl)morpholine;iron(2+) |
|---|---|
| PubChem CID | 15494645 |
| Molecular Formula | C15H19FeNO |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | cyclopenta-1,3-diene;4-(cyclopenta-2,4-dien-1-ylmethyl)morpholine;iron(2+) |
| SMILES | [Fe+2].c1cc[c-](CN2CCOCC2)c1.c1cc[cH-]c1 |
| InChI | InChI=1S/C10H14NO.C5H5.Fe/c1-2-4-10(3-1)9-11-5-7-12-8-6-11;1-2-4-5-3-1;/h1-4H,5-9H2;1-5H;/q2*-1;+2 |
| InChIKey | OQIHUQUVXDUBRI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|