C13H17NRu — CID 15807877
cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-yl-N,N-dimethylmethanamine;ruthenium(2+) (PubChem CID 15807877) has the molecular formula C13H17NRu and a molecular weight of 288.36 g/mol. Its IUPAC name is cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-yl-N,N-dimethylmethanamine;ruthenium(2+).
| Compound Name | cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-yl-N,N-dimethylmethanamine;ruthenium(2+) |
|---|---|
| PubChem CID | 15807877 |
| Molecular Formula | C13H17NRu |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | cyclopenta-1,3-diene;1-cyclopenta-2,4-dien-1-yl-N,N-dimethylmethanamine;ruthenium(2+) |
| SMILES | CN(C)C[c-]1cccc1.[Ru+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C8H12N.C5H5.Ru/c1-9(2)7-8-5-3-4-6-8;1-2-4-5-3-1;/h3-6H,7H2,1-2H3;1-5H;/q2*-1;+2 |
| InChIKey | SKINYTVMJHLTGY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|