C9H14KN — CID 15393928
potassium 2-cyclopenta-2,4-dien-1-yl-N,N-dimethylethanamine (PubChem CID 15393928) has the molecular formula C9H14KN and a molecular weight of 175.32 g/mol. Its IUPAC name is potassium 2-cyclopenta-2,4-dien-1-yl-N,N-dimethylethanamine.
| Compound Name | potassium 2-cyclopenta-2,4-dien-1-yl-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 15393928 |
| Molecular Formula | C9H14KN |
| Molecular Weight | 175.32 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | potassium 2-cyclopenta-2,4-dien-1-yl-N,N-dimethylethanamine |
| SMILES | CN(C)CC[c-]1cccc1.[K+] |
| InChI | InChI=1S/C9H14N.K/c1-10(2)8-7-9-5-3-4-6-9;/h3-6H,7-8H2,1-2H3;/q-1;+1 |
| InChIKey | VXJPYHVZPHJQOF-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.32 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|