C18H30HfSi2+2 — CID 175757243
bis(cyclopenta-2,4-dien-1-ylmethyl(trimethyl)silane);hafnium(4+) (PubChem CID 175757243) has the molecular formula C18H30HfSi2+2 and a molecular weight of 481.10 g/mol. Its IUPAC name is bis(cyclopenta-2,4-dien-1-ylmethyl(trimethyl)silane);hafnium(4+).
| Compound Name | bis(cyclopenta-2,4-dien-1-ylmethyl(trimethyl)silane);hafnium(4+) |
|---|---|
| PubChem CID | 175757243 |
| Molecular Formula | C18H30HfSi2+2 |
| Molecular Weight | 481.10 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | bis(cyclopenta-2,4-dien-1-ylmethyl(trimethyl)silane);hafnium(4+) |
| SMILES | C[Si](C)(C)C[c-]1cccc1.C[Si](C)(C)C[c-]1cccc1.[Hf+4] |
| InChI | InChI=1S/2C9H15Si.Hf/c2*1-10(2,3)8-9-6-4-5-7-9;/h2*4-7H,8H2,1-3H3;/q2*-1;+4 |
| InChIKey | OAXAWMKVEYPCLX-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.10 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|