C11H19LiOSi — CID 86199140
lithium 3-cyclopenta-2,4-dien-1-ylpropoxy(trimethyl)silane (PubChem CID 86199140) has the molecular formula C11H19LiOSi and a molecular weight of 202.30 g/mol. Its IUPAC name is lithium 3-cyclopenta-2,4-dien-1-ylpropoxy(trimethyl)silane.
| Compound Name | lithium 3-cyclopenta-2,4-dien-1-ylpropoxy(trimethyl)silane |
|---|---|
| PubChem CID | 86199140 |
| Molecular Formula | C11H19LiOSi |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | lithium 3-cyclopenta-2,4-dien-1-ylpropoxy(trimethyl)silane |
| SMILES | C[Si](C)(C)OCCC[c-]1cccc1.[Li+] |
| InChI | InChI=1S/C11H19OSi.Li/c1-13(2,3)12-10-6-9-11-7-4-5-8-11;/h4-5,7-8H,6,9-10H2,1-3H3;/q-1;+1 |
| InChIKey | UUWSRCCLPJWBMN-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|