C16H22Ti — CID 154426293
bis(5-propylcyclopenta-1,3-diene);titanium(2+) (PubChem CID 154426293) has the molecular formula C16H22Ti and a molecular weight of 262.22 g/mol. Its IUPAC name is bis(5-propylcyclopenta-1,3-diene);titanium(2+).
| Compound Name | bis(5-propylcyclopenta-1,3-diene);titanium(2+) |
|---|---|
| PubChem CID | 154426293 |
| Molecular Formula | C16H22Ti |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | bis(5-propylcyclopenta-1,3-diene);titanium(2+) |
| SMILES | CCC[c-]1cccc1.CCC[c-]1cccc1.[Ti+2] |
| InChI | InChI=1S/2C8H11.Ti/c2*1-2-5-8-6-3-4-7-8;/h2*3-4,6-7H,2,5H2,1H3;/q2*-1;+2 |
| InChIKey | HWILWEIQILUHNB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|