About dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;5-propylcyclopenta-1,3-diene
dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;5-propylcyclopenta-1,3-diene (PubChem CID 174349526) has the molecular formula C24H26Cl2Zr-2
and a molecular weight of 476.60 g/mol. Its IUPAC name is dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;5-propylcyclopenta-1,3-diene.
Molecular Properties
| Compound Name | dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;5-propylcyclopenta-1,3-diene |
| PubChem CID | 174349526 |
| Molecular Formula | C24H26Cl2Zr-2 |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;5-propylcyclopenta-1,3-diene |
| SMILES | CC(C)=[Zr](Cl)Cl.CCC[c-]1cccc1.c1ccc2c(c1)[cH-]c1ccccc12 |
| InChI | InChI=1S/C13H9.C8H11.C3H6.2ClH.Zr/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2-5-8-6-3-4-7-8;1-3-2;;;/h1-9H;3-4,6-7H,2,5H2,1H3;1-2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | XOLCCZOVCYMJER-UHFFFAOYSA-L |
| XLogP | 8.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;5-propylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;5-propylcyclopenta-1,3-diene?
The IUPAC name of dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;5-propylcyclopenta-1,3-diene (CID 174349526) is dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;5-propylcyclopenta-1,3-diene.
What is the SMILES notation for dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;5-propylcyclopenta-1,3-diene?
The canonical SMILES for dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;5-propylcyclopenta-1,3-diene is CC(C)=[Zr](Cl)Cl.CCC[c-]1cccc1.c1ccc2c(c1)[cH-]c1ccccc12.
What is the InChIKey of dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;5-propylcyclopenta-1,3-diene?
The InChIKey is XOLCCZOVCYMJER-UHFFFAOYSA-L. The full InChI is InChI=1S/C13H9.C8H11.C3H6.2ClH.Zr/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2-5-8-6-3-4-7-8;1-3-2;;;/h1-9H;3-4,6-7H,2,5H2,1H3;1-2H3;2*1H;/q2*-1;;;;+2/p-2.
What are the key properties of dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;5-propylcyclopenta-1,3-diene?
dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;5-propylcyclopenta-1,3-diene has a molecular weight of 476.60 g/mol, XLogP of 8.19, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro(propan-2-ylidene)zirconium;9H-fluoren-9-ide;5-propylcyclopenta-1,3-diene is sourced from PubChem (CID 174349526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).