C18H26Zr — CID 154429991
1,2,3,4,5-pentamethylcyclopenta-1,3-diene;5-propylcyclopenta-1,3-diene;zirconium(2+) (PubChem CID 154429991) has the molecular formula C18H26Zr and a molecular weight of 333.63 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethylcyclopenta-1,3-diene;5-propylcyclopenta-1,3-diene;zirconium(2+).
| Compound Name | 1,2,3,4,5-pentamethylcyclopenta-1,3-diene;5-propylcyclopenta-1,3-diene;zirconium(2+) |
|---|---|
| PubChem CID | 154429991 |
| Molecular Formula | C18H26Zr |
| Molecular Weight | 333.63 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 1,2,3,4,5-pentamethylcyclopenta-1,3-diene;5-propylcyclopenta-1,3-diene;zirconium(2+) |
| SMILES | CCC[c-]1cccc1.Cc1c(C)c(C)[c-](C)c1C.[Zr+2] |
| InChI | InChI=1S/C10H15.C8H11.Zr/c1-6-7(2)9(4)10(5)8(6)3;1-2-5-8-6-3-4-7-8;/h1-5H3;3-4,6-7H,2,5H2,1H3;/q2*-1;+2 |
| InChIKey | GPVBOIVSQHGFDX-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.63 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|