C14H27Ta — CID 15777144
carbanide;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;tantalum(5+) (PubChem CID 15777144) has the molecular formula C14H27Ta and a molecular weight of 376.32 g/mol. Its IUPAC name is carbanide;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;tantalum(5+).
| Compound Name | carbanide;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;tantalum(5+) |
|---|---|
| PubChem CID | 15777144 |
| Molecular Formula | C14H27Ta |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | carbanide;1,2,3,4,5-pentamethylcyclopenta-1,3-diene;tantalum(5+) |
| SMILES | Cc1c(C)c(C)[c-](C)c1C.[CH3-].[CH3-].[CH3-].[CH3-].[Ta+5] |
| InChI | InChI=1S/C10H15.4CH3.Ta/c1-6-7(2)9(4)10(5)8(6)3;;;;;/h1-5H3;4*1H3;/q5*-1;+5 |
| InChIKey | OHNMJBPMWIWCNP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|