C10H15Ni- — CID 141169485
nickel;1,2,3,4,5-pentamethylcyclopenta-1,3-diene (PubChem CID 141169485) has the molecular formula C10H15Ni- and a molecular weight of 193.92 g/mol. Its IUPAC name is nickel;1,2,3,4,5-pentamethylcyclopenta-1,3-diene.
| Compound Name | nickel;1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 141169485 |
| Molecular Formula | C10H15Ni- |
| Molecular Weight | 193.92 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | nickel;1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
| SMILES | Cc1c(C)c(C)[c-](C)c1C.[Ni] |
| InChI | InChI=1S/C10H15.Ni/c1-6-7(2)9(4)10(5)8(6)3;/h1-5H3;/q-1; |
| InChIKey | KXSBKTVSDZWKJP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.92 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|