C10H15Ru+ — CID 154465312
1,2,3,4,5-pentamethylcyclopenta-1,3-diene;ruthenium(2+) (PubChem CID 154465312) has the molecular formula C10H15Ru+ and a molecular weight of 236.30 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethylcyclopenta-1,3-diene;ruthenium(2+).
| Compound Name | 1,2,3,4,5-pentamethylcyclopenta-1,3-diene;ruthenium(2+) |
|---|---|
| PubChem CID | 154465312 |
| Molecular Formula | C10H15Ru+ |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 1,2,3,4,5-pentamethylcyclopenta-1,3-diene;ruthenium(2+) |
| SMILES | Cc1c(C)c(C)[c-](C)c1C.[Ru+2] |
| InChI | InChI=1S/C10H15.Ru/c1-6-7(2)9(4)10(5)8(6)3;/h1-5H3;/q-1;+2 |
| InChIKey | WHSUAYPAQAIUMV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|