C20H30Cl2Mo-2 — CID 155669320
dichloromolybdenum;bis(1,2,3,4,5-pentamethylcyclopenta-1,3-diene) (PubChem CID 155669320) has the molecular formula C20H30Cl2Mo-2 and a molecular weight of 437.31 g/mol. Its IUPAC name is dichloromolybdenum;bis(1,2,3,4,5-pentamethylcyclopenta-1,3-diene).
| Compound Name | dichloromolybdenum;bis(1,2,3,4,5-pentamethylcyclopenta-1,3-diene) |
|---|---|
| PubChem CID | 155669320 |
| Molecular Formula | C20H30Cl2Mo-2 |
| Molecular Weight | 437.31 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | dichloromolybdenum;bis(1,2,3,4,5-pentamethylcyclopenta-1,3-diene) |
| SMILES | Cc1c(C)c(C)[c-](C)c1C.Cc1c(C)c(C)[c-](C)c1C.Cl[Mo]Cl |
| InChI | InChI=1S/2C10H15.2ClH.Mo/c2*1-6-7(2)9(4)10(5)8(6)3;;;/h2*1-5H3;2*1H;/q2*-1;;;+2/p-2 |
| InChIKey | QLQMSOMUHIIOMP-UHFFFAOYSA-L |
| XLogP | 7.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.31 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|