C10H15Cl2Rh2+3 — CID 157049702
dichlororhodium(1+);1,2,3,4,5-pentamethylcyclopenta-1,3-diene;rhodium(3+) (PubChem CID 157049702) has the molecular formula C10H15Cl2Rh2+3 and a molecular weight of 411.95 g/mol. Its IUPAC name is dichlororhodium(1+);1,2,3,4,5-pentamethylcyclopenta-1,3-diene;rhodium(3+).
| Compound Name | dichlororhodium(1+);1,2,3,4,5-pentamethylcyclopenta-1,3-diene;rhodium(3+) |
|---|---|
| PubChem CID | 157049702 |
| Molecular Formula | C10H15Cl2Rh2+3 |
| Molecular Weight | 411.95 g/mol |
| Exact Mass | 410.86 |
| IUPAC Name | dichlororhodium(1+);1,2,3,4,5-pentamethylcyclopenta-1,3-diene;rhodium(3+) |
| SMILES | Cc1c(C)c(C)[c-](C)c1C.Cl[Rh+]Cl.[Rh+3] |
| InChI | InChI=1S/C10H15.2ClH.2Rh/c1-6-7(2)9(4)10(5)8(6)3;;;;/h1-5H3;2*1H;;/q-1;;;2*+3/p-2 |
| InChIKey | AAAZUDMIZHGEPZ-UHFFFAOYSA-L |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.95 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|