C12H21Cr — CID 139722502
carbanide;chromium(3+);1,2,3,4,5-pentamethylcyclopenta-1,3-diene (PubChem CID 139722502) has the molecular formula C12H21Cr and a molecular weight of 217.30 g/mol. Its IUPAC name is carbanide;chromium(3+);1,2,3,4,5-pentamethylcyclopenta-1,3-diene.
| Compound Name | carbanide;chromium(3+);1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 139722502 |
| Molecular Formula | C12H21Cr |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | carbanide;chromium(3+);1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
| SMILES | Cc1c(C)c(C)[c-](C)c1C.[CH3-].[CH3-].[Cr+3] |
| InChI | InChI=1S/C10H15.2CH3.Cr/c1-6-7(2)9(4)10(5)8(6)3;;;/h1-5H3;2*1H3;/q3*-1;+3 |
| InChIKey | NRHISZYXZKPROD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|