C18H26Cl2Zr — CID 159101421
5-butylcyclopenta-1,3-diene;1,2,3,5-tetramethylcyclopenta-1,3-diene;zirconium(4+);dichloride (PubChem CID 159101421) has the molecular formula C18H26Cl2Zr and a molecular weight of 404.54 g/mol. Its IUPAC name is 5-butylcyclopenta-1,3-diene;1,2,3,5-tetramethylcyclopenta-1,3-diene;zirconium(4+);dichloride.
| Compound Name | 5-butylcyclopenta-1,3-diene;1,2,3,5-tetramethylcyclopenta-1,3-diene;zirconium(4+);dichloride |
|---|---|
| PubChem CID | 159101421 |
| Molecular Formula | C18H26Cl2Zr |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 5-butylcyclopenta-1,3-diene;1,2,3,5-tetramethylcyclopenta-1,3-diene;zirconium(4+);dichloride |
| SMILES | CCCC[c-]1cccc1.Cc1c[c-](C)c(C)c1C.[Cl-].[Cl-].[Zr+4] |
| InChI | InChI=1S/2C9H13.2ClH.Zr/c1-6-5-7(2)9(4)8(6)3;1-2-3-6-9-7-4-5-8-9;;;/h5H,1-4H3;4-5,7-8H,2-3,6H2,1H3;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | RWRHUTSPJDROOM-UHFFFAOYSA-L |
| XLogP | -0.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|