C20H30Zr — CID 154068384
bis(5-butyl-2-methylcyclopenta-1,3-diene);zirconium(2+) (PubChem CID 154068384) has the molecular formula C20H30Zr and a molecular weight of 361.68 g/mol. Its IUPAC name is bis(5-butyl-2-methylcyclopenta-1,3-diene);zirconium(2+).
| Compound Name | bis(5-butyl-2-methylcyclopenta-1,3-diene);zirconium(2+) |
|---|---|
| PubChem CID | 154068384 |
| Molecular Formula | C20H30Zr |
| Molecular Weight | 361.68 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | bis(5-butyl-2-methylcyclopenta-1,3-diene);zirconium(2+) |
| SMILES | CCCC[c-]1ccc(C)c1.CCCC[c-]1ccc(C)c1.[Zr+2] |
| InChI | InChI=1S/2C10H15.Zr/c2*1-3-4-5-10-7-6-9(2)8-10;/h2*6-8H,3-5H2,1-2H3;/q2*-1;+2 |
| InChIKey | VBZNWRUKPMNYRJ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.68 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|