About 5-ethyl-2-methylcyclopenta-1,3-diene;vanadium
5-ethyl-2-methylcyclopenta-1,3-diene;vanadium (PubChem CID 154419789) has the molecular formula C8H11V-
and a molecular weight of 158.12 g/mol. Its IUPAC name is 5-ethyl-2-methylcyclopenta-1,3-diene;vanadium.
Molecular Properties
| Compound Name | 5-ethyl-2-methylcyclopenta-1,3-diene;vanadium |
| PubChem CID | 154419789 |
| Molecular Formula | C8H11V- |
| Molecular Weight | 158.12 g/mol |
| Exact Mass | 158.03 |
| IUPAC Name | 5-ethyl-2-methylcyclopenta-1,3-diene;vanadium |
| SMILES | CC[c-]1ccc(C)c1.[V] |
| InChI | InChI=1S/C8H11.V/c1-3-8-5-4-7(2)6-8;/h4-6H,3H2,1-2H3;/q-1; |
| InChIKey | DDJVWTZEGPJOQK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.12 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-2-methylcyclopenta-1,3-diene;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-methylcyclopenta-1,3-diene;vanadium?
The IUPAC name of 5-ethyl-2-methylcyclopenta-1,3-diene;vanadium (CID 154419789) is 5-ethyl-2-methylcyclopenta-1,3-diene;vanadium.
What is the SMILES notation for 5-ethyl-2-methylcyclopenta-1,3-diene;vanadium?
The canonical SMILES for 5-ethyl-2-methylcyclopenta-1,3-diene;vanadium is CC[c-]1ccc(C)c1.[V].
What is the InChIKey of 5-ethyl-2-methylcyclopenta-1,3-diene;vanadium?
The InChIKey is DDJVWTZEGPJOQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11.V/c1-3-8-5-4-7(2)6-8;/h4-6H,3H2,1-2H3;/q-1;.
What are the key properties of 5-ethyl-2-methylcyclopenta-1,3-diene;vanadium?
5-ethyl-2-methylcyclopenta-1,3-diene;vanadium has a molecular weight of 158.12 g/mol, XLogP of 2.27, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-methylcyclopenta-1,3-diene;vanadium is sourced from PubChem (CID 154419789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).