C7H9Cl2Ti — CID 159160331
2,5-dimethylcyclopenta-1,3-diene;titanium(3+);dichloride (PubChem CID 159160331) has the molecular formula C7H9Cl2Ti and a molecular weight of 211.92 g/mol. Its IUPAC name is 2,5-dimethylcyclopenta-1,3-diene;titanium(3+);dichloride.
| Compound Name | 2,5-dimethylcyclopenta-1,3-diene;titanium(3+);dichloride |
|---|---|
| PubChem CID | 159160331 |
| Molecular Formula | C7H9Cl2Ti |
| Molecular Weight | 211.92 g/mol |
| Exact Mass | 210.96 |
| IUPAC Name | 2,5-dimethylcyclopenta-1,3-diene;titanium(3+);dichloride |
| SMILES | Cc1cc[c-](C)c1.[Cl-].[Cl-].[Ti+3] |
| InChI | InChI=1S/C7H9.2ClH.Ti/c1-6-3-4-7(2)5-6;;;/h3-5H,1-2H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | NHCJKLSTAOUNPU-UHFFFAOYSA-L |
| XLogP | -3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.92 |
| LogP ≤ 5 | -3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|