C21H30Cl2Zr — CID 141245726
2-cyclopentyl-5-methylcyclopenta-1,3-diene;dichlorozirconium(2+);1,2,3,4,5-pentamethylcyclopenta-1,3-diene (PubChem CID 141245726) has the molecular formula C21H30Cl2Zr and a molecular weight of 444.60 g/mol. Its IUPAC name is 2-cyclopentyl-5-methylcyclopenta-1,3-diene;dichlorozirconium(2+);1,2,3,4,5-pentamethylcyclopenta-1,3-diene.
| Compound Name | 2-cyclopentyl-5-methylcyclopenta-1,3-diene;dichlorozirconium(2+);1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 141245726 |
| Molecular Formula | C21H30Cl2Zr |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 2-cyclopentyl-5-methylcyclopenta-1,3-diene;dichlorozirconium(2+);1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
| SMILES | C[c-]1ccc(C2CCCC2)c1.Cc1c(C)c(C)[c-](C)c1C.Cl[Zr+2]Cl |
| InChI | InChI=1S/C11H15.C10H15.2ClH.Zr/c1-9-6-7-11(8-9)10-4-2-3-5-10;1-6-7(2)9(4)10(5)8(6)3;;;/h6-8,10H,2-5H2,1H3;1-5H3;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | BFSZIDYHIQGVCC-UHFFFAOYSA-L |
| XLogP | 7.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|