C27H24Zr — CID 173158166
benzylidenezirconium(2+);2,5-dimethylcyclopenta-1,3-diene;9H-fluoren-9-ide (PubChem CID 173158166) has the molecular formula C27H24Zr and a molecular weight of 439.71 g/mol. Its IUPAC name is benzylidenezirconium(2+);2,5-dimethylcyclopenta-1,3-diene;9H-fluoren-9-ide.
| Compound Name | benzylidenezirconium(2+);2,5-dimethylcyclopenta-1,3-diene;9H-fluoren-9-ide |
|---|---|
| PubChem CID | 173158166 |
| Molecular Formula | C27H24Zr |
| Molecular Weight | 439.71 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | benzylidenezirconium(2+);2,5-dimethylcyclopenta-1,3-diene;9H-fluoren-9-ide |
| SMILES | Cc1cc[c-](C)c1.[Zr+2]=Cc1ccccc1.c1ccc2c(c1)[cH-]c1ccccc12 |
| InChI | InChI=1S/C13H9.C7H9.C7H6.Zr/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-6-3-4-7(2)5-6;1-7-5-3-2-4-6-7;/h1-9H;3-5H,1-2H3;1-6H;/q2*-1;;+2 |
| InChIKey | PMRPKCCTEHEIKH-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.71 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|