C12H11- — CID 123646897
(3-methylcyclopenta-1,4-dien-1-yl)benzene (PubChem CID 123646897) has the molecular formula C12H11- and a molecular weight of 155.22 g/mol. Its IUPAC name is (3-methylcyclopenta-1,4-dien-1-yl)benzene.
| Compound Name | (3-methylcyclopenta-1,4-dien-1-yl)benzene |
|---|---|
| PubChem CID | 123646897 |
| Molecular Formula | C12H11- |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (3-methylcyclopenta-1,4-dien-1-yl)benzene |
| SMILES | C[c-]1ccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C12H11/c1-10-7-8-12(9-10)11-5-3-2-4-6-11/h2-9H,1H3/q-1 |
| InChIKey | YZEVSSMYWCYWOX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|