About lithium (3-phenylcyclopenta-1,4-dien-1-yl)benzene
lithium (3-phenylcyclopenta-1,4-dien-1-yl)benzene (PubChem CID 71443345) has the molecular formula C17H13Li
and a molecular weight of 224.23 g/mol. Its IUPAC name is lithium (3-phenylcyclopenta-1,4-dien-1-yl)benzene.
Molecular Properties
| Compound Name | lithium (3-phenylcyclopenta-1,4-dien-1-yl)benzene |
| PubChem CID | 71443345 |
| Molecular Formula | C17H13Li |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | lithium (3-phenylcyclopenta-1,4-dien-1-yl)benzene |
| SMILES | [Li+].c1ccc(-c2cc[c-](-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C17H13.Li/c1-3-7-14(8-4-1)16-11-12-17(13-16)15-9-5-2-6-10-15;/h1-13H;/q-1;+1 |
| InChIKey | LZFDZIBLIAPZSP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium (3-phenylcyclopenta-1,4-dien-1-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium (3-phenylcyclopenta-1,4-dien-1-yl)benzene?
The IUPAC name of lithium (3-phenylcyclopenta-1,4-dien-1-yl)benzene (CID 71443345) is lithium (3-phenylcyclopenta-1,4-dien-1-yl)benzene.
What is the SMILES notation for lithium (3-phenylcyclopenta-1,4-dien-1-yl)benzene?
The canonical SMILES for lithium (3-phenylcyclopenta-1,4-dien-1-yl)benzene is [Li+].c1ccc(-c2cc[c-](-c3ccccc3)c2)cc1.
What is the InChIKey of lithium (3-phenylcyclopenta-1,4-dien-1-yl)benzene?
The InChIKey is LZFDZIBLIAPZSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13.Li/c1-3-7-14(8-4-1)16-11-12-17(13-16)15-9-5-2-6-10-15;/h1-13H;/q-1;+1.
What are the key properties of lithium (3-phenylcyclopenta-1,4-dien-1-yl)benzene?
lithium (3-phenylcyclopenta-1,4-dien-1-yl)benzene has a molecular weight of 224.23 g/mol, XLogP of 1.74, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium (3-phenylcyclopenta-1,4-dien-1-yl)benzene is sourced from PubChem (CID 71443345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).