C12H11Li — CID 71443344
lithium (3-methylcyclopenta-1,4-dien-1-yl)benzene (PubChem CID 71443344) has the molecular formula C12H11Li and a molecular weight of 162.16 g/mol. Its IUPAC name is lithium (3-methylcyclopenta-1,4-dien-1-yl)benzene.
| Compound Name | lithium (3-methylcyclopenta-1,4-dien-1-yl)benzene |
|---|---|
| PubChem CID | 71443344 |
| Molecular Formula | C12H11Li |
| Molecular Weight | 162.16 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | lithium (3-methylcyclopenta-1,4-dien-1-yl)benzene |
| SMILES | C[c-]1ccc(-c2ccccc2)c1.[Li+] |
| InChI | InChI=1S/C12H11.Li/c1-10-7-8-12(9-10)11-5-3-2-4-6-11;/h2-9H,1H3;/q-1;+1 |
| InChIKey | XFJXSHHITGTSBT-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.16 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|