C8H11Zr- — CID 154080845
5-ethyl-2-methylcyclopenta-1,3-diene;zirconium (PubChem CID 154080845) has the molecular formula C8H11Zr- and a molecular weight of 198.40 g/mol. Its IUPAC name is 5-ethyl-2-methylcyclopenta-1,3-diene;zirconium.
| Compound Name | 5-ethyl-2-methylcyclopenta-1,3-diene;zirconium |
|---|---|
| PubChem CID | 154080845 |
| Molecular Formula | C8H11Zr- |
| Molecular Weight | 198.40 g/mol |
| Exact Mass | 196.99 |
| IUPAC Name | 5-ethyl-2-methylcyclopenta-1,3-diene;zirconium |
| SMILES | CC[c-]1ccc(C)c1.[Zr] |
| InChI | InChI=1S/C8H11.Zr/c1-3-8-5-4-7(2)6-8;/h4-6H,3H2,1-2H3;/q-1; |
| InChIKey | OSAWHBRNYFNFHE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|