C26H42Zr — CID 154068385
bis(2,5-dibutylcyclopenta-1,3-diene);zirconium(2+) (PubChem CID 154068385) has the molecular formula C26H42Zr and a molecular weight of 445.85 g/mol. Its IUPAC name is bis(2,5-dibutylcyclopenta-1,3-diene);zirconium(2+).
| Compound Name | bis(2,5-dibutylcyclopenta-1,3-diene);zirconium(2+) |
|---|---|
| PubChem CID | 154068385 |
| Molecular Formula | C26H42Zr |
| Molecular Weight | 445.85 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | bis(2,5-dibutylcyclopenta-1,3-diene);zirconium(2+) |
| SMILES | CCCCc1cc[c-](CCCC)c1.CCCCc1cc[c-](CCCC)c1.[Zr+2] |
| InChI | InChI=1S/2C13H21.Zr/c2*1-3-5-7-12-9-10-13(11-12)8-6-4-2;/h2*9-11H,3-8H2,1-2H3;/q2*-1;+2 |
| InChIKey | DBKBDSUUKSPOQF-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.85 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|