C45H80Fe — CID 158268933
2,5-dipentylcyclopenta-1,3-diene;iron(2+);1,2,3,4,5-pentapentylcyclopenta-1,3-diene (PubChem CID 158268933) has the molecular formula C45H80Fe and a molecular weight of 676.98 g/mol. Its IUPAC name is 2,5-dipentylcyclopenta-1,3-diene;iron(2+);1,2,3,4,5-pentapentylcyclopenta-1,3-diene.
| Compound Name | 2,5-dipentylcyclopenta-1,3-diene;iron(2+);1,2,3,4,5-pentapentylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 158268933 |
| Molecular Formula | C45H80Fe |
| Molecular Weight | 676.98 g/mol |
| Exact Mass | 676.56 |
| IUPAC Name | 2,5-dipentylcyclopenta-1,3-diene;iron(2+);1,2,3,4,5-pentapentylcyclopenta-1,3-diene |
| SMILES | CCCCCc1c(CCCCC)c(CCCCC)[c-](CCCCC)c1CCCCC.CCCCCc1cc[c-](CCCCC)c1.[Fe+2] |
| InChI | InChI=1S/C30H55.C15H25.Fe/c1-6-11-16-21-26-27(22-17-12-7-2)29(24-19-14-9-4)30(25-20-15-10-5)28(26)23-18-13-8-3;1-3-5-7-9-14-11-12-15(13-14)10-8-6-4-2;/h6-25H2,1-5H3;11-13H,3-10H2,1-2H3;/q2*-1;+2 |
| InChIKey | GIUHALWOTSCYGI-UHFFFAOYSA-N |
| XLogP | 14.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 28 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.98 |
| LogP ≤ 5 | 14.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|