C22H34Fe-6 — CID 173240829
2,5-dipropylcyclopenta-1,3-diene;1,3-dipropylcyclopentane;iron (PubChem CID 173240829) has the molecular formula C22H34Fe-6 and a molecular weight of 354.36 g/mol. Its IUPAC name is 2,5-dipropylcyclopenta-1,3-diene;1,3-dipropylcyclopentane;iron.
| Compound Name | 2,5-dipropylcyclopenta-1,3-diene;1,3-dipropylcyclopentane;iron |
|---|---|
| PubChem CID | 173240829 |
| Molecular Formula | C22H34Fe-6 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 2,5-dipropylcyclopenta-1,3-diene;1,3-dipropylcyclopentane;iron |
| SMILES | CCC[c-]1[cH-][cH-][c-](CCC)[cH-]1.CCCc1cc[c-](CCC)c1.[Fe] |
| InChI | InChI=1S/2C11H17.Fe/c2*1-3-5-10-7-8-11(9-10)6-4-2;/h2*7-9H,3-6H2,1-2H3;/q-5;-1; |
| InChIKey | QEPLWJAEJAMYBU-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|