C18H20Hf-2 — CID 154419995
5-butylcyclopenta-1,3-diene;hafnium;1H-inden-1-ide (PubChem CID 154419995) has the molecular formula C18H20Hf-2 and a molecular weight of 414.85 g/mol. Its IUPAC name is 5-butylcyclopenta-1,3-diene;hafnium;1H-inden-1-ide.
| Compound Name | 5-butylcyclopenta-1,3-diene;hafnium;1H-inden-1-ide |
|---|---|
| PubChem CID | 154419995 |
| Molecular Formula | C18H20Hf-2 |
| Molecular Weight | 414.85 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 5-butylcyclopenta-1,3-diene;hafnium;1H-inden-1-ide |
| SMILES | CCCC[c-]1cccc1.[Hf].c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C9H7.C9H13.Hf/c1-2-5-9-7-3-6-8(9)4-1;1-2-3-6-9-7-4-5-8-9;/h1-7H;4-5,7-8H,2-3,6H2,1H3;/q2*-1; |
| InChIKey | YNYBZQBVKMCMMV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.85 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|