About tris(dipropylazanide);1H-inden-1-ide;titanium(4+)
tris(dipropylazanide);1H-inden-1-ide;titanium(4+) (PubChem CID 158782041) has the molecular formula C27H49N3Ti
and a molecular weight of 463.58 g/mol. Its IUPAC name is tris(dipropylazanide);1H-inden-1-ide;titanium(4+).
Molecular Properties
| Compound Name | tris(dipropylazanide);1H-inden-1-ide;titanium(4+) |
| PubChem CID | 158782041 |
| Molecular Formula | C27H49N3Ti |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.34 |
| IUPAC Name | tris(dipropylazanide);1H-inden-1-ide;titanium(4+) |
| SMILES | CCC[N-]CCC.CCC[N-]CCC.CCC[N-]CCC.[Ti+4].c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C9H7.3C6H14N.Ti/c1-2-5-9-7-3-6-8(9)4-1;3*1-3-5-7-6-4-2;/h1-7H;3*3-6H2,1-2H3;/q4*-1;+4 |
| InChIKey | WAMCWFWFUIHUCK-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 42.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze tris(dipropylazanide);1H-inden-1-ide;titanium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(dipropylazanide);1H-inden-1-ide;titanium(4+)?
The IUPAC name of tris(dipropylazanide);1H-inden-1-ide;titanium(4+) (CID 158782041) is tris(dipropylazanide);1H-inden-1-ide;titanium(4+).
What is the SMILES notation for tris(dipropylazanide);1H-inden-1-ide;titanium(4+)?
The canonical SMILES for tris(dipropylazanide);1H-inden-1-ide;titanium(4+) is CCC[N-]CCC.CCC[N-]CCC.CCC[N-]CCC.[Ti+4].c1ccc2[cH-]ccc2c1.
What is the InChIKey of tris(dipropylazanide);1H-inden-1-ide;titanium(4+)?
The InChIKey is WAMCWFWFUIHUCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7.3C6H14N.Ti/c1-2-5-9-7-3-6-8(9)4-1;3*1-3-5-7-6-4-2;/h1-7H;3*3-6H2,1-2H3;/q4*-1;+4.
What are the key properties of tris(dipropylazanide);1H-inden-1-ide;titanium(4+)?
tris(dipropylazanide);1H-inden-1-ide;titanium(4+) has a molecular weight of 463.58 g/mol, XLogP of 9.10, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tris(dipropylazanide);1H-inden-1-ide;titanium(4+) is sourced from PubChem (CID 158782041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).