About ethanolate;hafnium;1H-inden-1-ide
ethanolate;hafnium;1H-inden-1-ide (PubChem CID 159970065) has the molecular formula C13H17HfO2-3
and a molecular weight of 383.77 g/mol. Its IUPAC name is ethanolate;hafnium;1H-inden-1-ide.
Molecular Properties
| Compound Name | ethanolate;hafnium;1H-inden-1-ide |
| PubChem CID | 159970065 |
| Molecular Formula | C13H17HfO2-3 |
| Molecular Weight | 383.77 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | ethanolate;hafnium;1H-inden-1-ide |
| SMILES | CC[O-].CC[O-].[Hf].c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C9H7.2C2H5O.Hf/c1-2-5-9-7-3-6-8(9)4-1;2*1-2-3;/h1-7H;2*2H2,1H3;/q3*-1; |
| InChIKey | CQZNIITTYFLQFX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.77 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethanolate;hafnium;1H-inden-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanolate;hafnium;1H-inden-1-ide?
The IUPAC name of ethanolate;hafnium;1H-inden-1-ide (CID 159970065) is ethanolate;hafnium;1H-inden-1-ide.
What is the SMILES notation for ethanolate;hafnium;1H-inden-1-ide?
The canonical SMILES for ethanolate;hafnium;1H-inden-1-ide is CC[O-].CC[O-].[Hf].c1ccc2[cH-]ccc2c1.
What is the InChIKey of ethanolate;hafnium;1H-inden-1-ide?
The InChIKey is CQZNIITTYFLQFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7.2C2H5O.Hf/c1-2-5-9-7-3-6-8(9)4-1;2*1-2-3;/h1-7H;2*2H2,1H3;/q3*-1;.
What are the key properties of ethanolate;hafnium;1H-inden-1-ide?
ethanolate;hafnium;1H-inden-1-ide has a molecular weight of 383.77 g/mol, XLogP of 1.29, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanolate;hafnium;1H-inden-1-ide is sourced from PubChem (CID 159970065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).