About 1H-inden-1-ide;titanium;dihydrochloride
1H-inden-1-ide;titanium;dihydrochloride (PubChem CID 87738152) has the molecular formula C9H9Cl2Ti-
and a molecular weight of 235.94 g/mol. Its IUPAC name is 1H-inden-1-ide;titanium;dihydrochloride.
Molecular Properties
| Compound Name | 1H-inden-1-ide;titanium;dihydrochloride |
| PubChem CID | 87738152 |
| Molecular Formula | C9H9Cl2Ti- |
| Molecular Weight | 235.94 g/mol |
| Exact Mass | 234.96 |
| IUPAC Name | 1H-inden-1-ide;titanium;dihydrochloride |
| SMILES | Cl.Cl.[Ti].c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C9H7.2ClH.Ti/c1-2-5-9-7-3-6-8(9)4-1;;;/h1-7H;2*1H;/q-1;;; |
| InChIKey | ODPLMBGMARHKEO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.94 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1H-inden-1-ide;titanium;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-inden-1-ide;titanium;dihydrochloride?
The IUPAC name of 1H-inden-1-ide;titanium;dihydrochloride (CID 87738152) is 1H-inden-1-ide;titanium;dihydrochloride.
What is the SMILES notation for 1H-inden-1-ide;titanium;dihydrochloride?
The canonical SMILES for 1H-inden-1-ide;titanium;dihydrochloride is Cl.Cl.[Ti].c1ccc2[cH-]ccc2c1.
What is the InChIKey of 1H-inden-1-ide;titanium;dihydrochloride?
The InChIKey is ODPLMBGMARHKEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7.2ClH.Ti/c1-2-5-9-7-3-6-8(9)4-1;;;/h1-7H;2*1H;/q-1;;;.
What are the key properties of 1H-inden-1-ide;titanium;dihydrochloride?
1H-inden-1-ide;titanium;dihydrochloride has a molecular weight of 235.94 g/mol, XLogP of 3.40, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-inden-1-ide;titanium;dihydrochloride is sourced from PubChem (CID 87738152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).