C14H12Ti — CID 154419987
cyclopenta-1,3-diene;1H-inden-1-ide;titanium(2+) (PubChem CID 154419987) has the molecular formula C14H12Ti and a molecular weight of 228.12 g/mol. Its IUPAC name is cyclopenta-1,3-diene;1H-inden-1-ide;titanium(2+).
| Compound Name | cyclopenta-1,3-diene;1H-inden-1-ide;titanium(2+) |
|---|---|
| PubChem CID | 154419987 |
| Molecular Formula | C14H12Ti |
| Molecular Weight | 228.12 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | cyclopenta-1,3-diene;1H-inden-1-ide;titanium(2+) |
| SMILES | [Ti+2].c1cc[cH-]c1.c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C9H7.C5H5.Ti/c1-2-5-9-7-3-6-8(9)4-1;1-2-4-5-3-1;/h1-7H;1-5H;/q2*-1;+2 |
| InChIKey | RJVZDZHUTUVCKZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.12 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|