C14H12Cl2Zr — CID 15397844
cyclopenta-1,3-diene;dichlorozirconium(2+);1H-inden-1-ide (PubChem CID 15397844) has the molecular formula C14H12Cl2Zr and a molecular weight of 342.38 g/mol. Its IUPAC name is cyclopenta-1,3-diene;dichlorozirconium(2+);1H-inden-1-ide.
| Compound Name | cyclopenta-1,3-diene;dichlorozirconium(2+);1H-inden-1-ide |
|---|---|
| PubChem CID | 15397844 |
| Molecular Formula | C14H12Cl2Zr |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 339.94 |
| IUPAC Name | cyclopenta-1,3-diene;dichlorozirconium(2+);1H-inden-1-ide |
| SMILES | Cl[Zr+2]Cl.c1cc[cH-]c1.c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C9H7.C5H5.2ClH.Zr/c1-2-5-9-7-3-6-8(9)4-1;1-2-4-5-3-1;;;/h1-7H;1-5H;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | WRJRCNTUXGXVOR-UHFFFAOYSA-L |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|