About 1H-inden-1-ide;titanium(3+);difluoride
1H-inden-1-ide;titanium(3+);difluoride (PubChem CID 87792956) has the molecular formula C9H7F2Ti
and a molecular weight of 201.02 g/mol. Its IUPAC name is 1H-inden-1-ide;titanium(3+);difluoride.
Molecular Properties
| Compound Name | 1H-inden-1-ide;titanium(3+);difluoride |
| PubChem CID | 87792956 |
| Molecular Formula | C9H7F2Ti |
| Molecular Weight | 201.02 g/mol |
| Exact Mass | 201.00 |
| IUPAC Name | 1H-inden-1-ide;titanium(3+);difluoride |
| SMILES | [F-].[F-].[Ti+3].c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C9H7.2FH.Ti/c1-2-5-9-7-3-6-8(9)4-1;;;/h1-7H;2*1H;/q-1;;;+3/p-2 |
| InChIKey | ZPTIZMVZSJUVFV-UHFFFAOYSA-L |
| XLogP | -3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.02 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1H-inden-1-ide;titanium(3+);difluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-inden-1-ide;titanium(3+);difluoride?
The IUPAC name of 1H-inden-1-ide;titanium(3+);difluoride (CID 87792956) is 1H-inden-1-ide;titanium(3+);difluoride.
What is the SMILES notation for 1H-inden-1-ide;titanium(3+);difluoride?
The canonical SMILES for 1H-inden-1-ide;titanium(3+);difluoride is [F-].[F-].[Ti+3].c1ccc2[cH-]ccc2c1.
What is the InChIKey of 1H-inden-1-ide;titanium(3+);difluoride?
The InChIKey is ZPTIZMVZSJUVFV-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H7.2FH.Ti/c1-2-5-9-7-3-6-8(9)4-1;;;/h1-7H;2*1H;/q-1;;;+3/p-2.
What are the key properties of 1H-inden-1-ide;titanium(3+);difluoride?
1H-inden-1-ide;titanium(3+);difluoride has a molecular weight of 201.02 g/mol, XLogP of -3.44, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-inden-1-ide;titanium(3+);difluoride is sourced from PubChem (CID 87792956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).