C14H12Zr+2 — CID 175934824
cyclopenta-1,3-diene;1H-inden-1-ide;zirconium(4+) (PubChem CID 175934824) has the molecular formula C14H12Zr+2 and a molecular weight of 271.47 g/mol. Its IUPAC name is cyclopenta-1,3-diene;1H-inden-1-ide;zirconium(4+).
| Compound Name | cyclopenta-1,3-diene;1H-inden-1-ide;zirconium(4+) |
|---|---|
| PubChem CID | 175934824 |
| Molecular Formula | C14H12Zr+2 |
| Molecular Weight | 271.47 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | cyclopenta-1,3-diene;1H-inden-1-ide;zirconium(4+) |
| SMILES | [Zr+4].c1cc[cH-]c1.c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C9H7.C5H5.Zr/c1-2-5-9-7-3-6-8(9)4-1;1-2-4-5-3-1;/h1-7H;1-5H;/q2*-1;+4 |
| InChIKey | DJNXLYQLJMPXPD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|