About 1-butylinden-1-ide;carbanide;hafnium
1-butylinden-1-ide;carbanide;hafnium (PubChem CID 175086172) has the molecular formula C15H21Hf-3
and a molecular weight of 379.82 g/mol. Its IUPAC name is 1-butylinden-1-ide;carbanide;hafnium.
Molecular Properties
| Compound Name | 1-butylinden-1-ide;carbanide;hafnium |
| PubChem CID | 175086172 |
| Molecular Formula | C15H21Hf-3 |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 1-butylinden-1-ide;carbanide;hafnium |
| SMILES | CCCC[c-]1ccc2ccccc21.[CH3-].[CH3-].[Hf] |
| InChI | InChI=1S/C13H15.2CH3.Hf/c1-2-3-6-11-9-10-12-7-4-5-8-13(11)12;;;/h4-5,7-10H,2-3,6H2,1H3;2*1H3;/q3*-1; |
| InChIKey | ZPDMVZPQGRPGCG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-butylinden-1-ide;carbanide;hafnium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylinden-1-ide;carbanide;hafnium?
The IUPAC name of 1-butylinden-1-ide;carbanide;hafnium (CID 175086172) is 1-butylinden-1-ide;carbanide;hafnium.
What is the SMILES notation for 1-butylinden-1-ide;carbanide;hafnium?
The canonical SMILES for 1-butylinden-1-ide;carbanide;hafnium is CCCC[c-]1ccc2ccccc21.[CH3-].[CH3-].[Hf].
What is the InChIKey of 1-butylinden-1-ide;carbanide;hafnium?
The InChIKey is ZPDMVZPQGRPGCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15.2CH3.Hf/c1-2-3-6-11-9-10-12-7-4-5-8-13(11)12;;;/h4-5,7-10H,2-3,6H2,1H3;2*1H3;/q3*-1;.
What are the key properties of 1-butylinden-1-ide;carbanide;hafnium?
1-butylinden-1-ide;carbanide;hafnium has a molecular weight of 379.82 g/mol, XLogP of 4.80, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylinden-1-ide;carbanide;hafnium is sourced from PubChem (CID 175086172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).