C15H17Hf- — CID 175279371
hafnium;5-propyl-2,3-dihydro-1H-s-indacen-5-ide (PubChem CID 175279371) has the molecular formula C15H17Hf- and a molecular weight of 375.79 g/mol. Its IUPAC name is hafnium;5-propyl-2,3-dihydro-1H-s-indacen-5-ide.
| Compound Name | hafnium;5-propyl-2,3-dihydro-1H-s-indacen-5-ide |
|---|---|
| PubChem CID | 175279371 |
| Molecular Formula | C15H17Hf- |
| Molecular Weight | 375.79 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | hafnium;5-propyl-2,3-dihydro-1H-s-indacen-5-ide |
| SMILES | CCC[c-]1ccc2cc3c(cc21)CCC3.[Hf] |
| InChI | InChI=1S/C15H17.Hf/c1-2-4-11-7-8-14-9-12-5-3-6-13(12)10-15(11)14;/h7-10H,2-6H2,1H3;/q-1; |
| InChIKey | OKOJADYQGZGNOY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.79 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|