C27H36Hf-2 — CID 175740981
5-(2,2-dimethylpropyl)-2,3-dihydro-1H-s-indacen-5-ide;hafnium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene (PubChem CID 175740981) has the molecular formula C27H36Hf-2 and a molecular weight of 539.08 g/mol. Its IUPAC name is 5-(2,2-dimethylpropyl)-2,3-dihydro-1H-s-indacen-5-ide;hafnium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene.
| Compound Name | 5-(2,2-dimethylpropyl)-2,3-dihydro-1H-s-indacen-5-ide;hafnium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 175740981 |
| Molecular Formula | C27H36Hf-2 |
| Molecular Weight | 539.08 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 5-(2,2-dimethylpropyl)-2,3-dihydro-1H-s-indacen-5-ide;hafnium;1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
| SMILES | CC(C)(C)C[c-]1ccc2cc3c(cc21)CCC3.Cc1c(C)c(C)[c-](C)c1C.[Hf] |
| InChI | InChI=1S/C17H21.C10H15.Hf/c1-17(2,3)11-15-8-7-14-9-12-5-4-6-13(12)10-16(14)15;1-6-7(2)9(4)10(5)8(6)3;/h7-10H,4-6,11H2,1-3H3;1-5H3;/q2*-1; |
| InChIKey | LZBIVZCVWWFDKB-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.08 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|