C15H18 — CID 158805495
methane;1,2,3,4-tetrahydroanthracene (PubChem CID 158805495) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is methane;1,2,3,4-tetrahydroanthracene.
| Compound Name | methane;1,2,3,4-tetrahydroanthracene |
|---|---|
| PubChem CID | 158805495 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | methane;1,2,3,4-tetrahydroanthracene |
| SMILES | C.c1ccc2cc3c(cc2c1)CCCC3 |
| InChI | InChI=1S/C14H14.CH4/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;/h1-2,5-6,9-10H,3-4,7-8H2;1H4 |
| InChIKey | IUAIJOJFLJQIHF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |